C28H30BrN3O5 — CID 23808125
[(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23808125) has the molecular formula C28H30BrN3O5 and a molecular weight of 568.47 g/mol. Its IUPAC name is [(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23808125 |
| Molecular Formula | C28H30BrN3O5 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.14 |
| IUPAC Name | [(E,1S)-5-(2-aminoanilino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
| SMILES | CC(C)(/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc(Br)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C28H30BrN3O5/c1-28(2,15-14-25(34)32-24-9-4-3-8-23(24)30)26(19-6-5-7-22(18-19)36-17-16-33)37-27(35)31-21-12-10-20(29)11-13-21/h3-15,18,26,33H,16-17,30H2,1-2H3,(H,31,35)(H,32,34)/b15-14+/t26-/m1/s1 |
| InChIKey | ULKIRPLHADNBKG-ZUSJUXBOSA-N |
| XLogP | 5.91 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|