C28H28BrN3O5 — CID 23920642
[(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-2,2-dimethyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23920642) has the molecular formula C28H28BrN3O5 and a molecular weight of 566.45 g/mol. Its IUPAC name is [(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-2,2-dimethyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-2,2-dimethyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23920642 |
| Molecular Formula | C28H28BrN3O5 |
| Molecular Weight | 566.45 g/mol |
| Exact Mass | 565.12 |
| IUPAC Name | [(E,1R)-5-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-2,2-dimethyl-5-oxopent-3-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@@H](c2cc(Br)ccc2O)C(C)(C)/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C28H28BrN3O5/c1-17(33)18-8-11-20(12-9-18)31-27(36)37-26(21-16-19(29)10-13-24(21)34)28(2,3)15-14-25(35)32-23-7-5-4-6-22(23)30/h4-16,26,34H,30H2,1-3H3,(H,31,36)(H,32,35)/b15-14+/t26-/m0/s1 |
| InChIKey | QUIFLFDALZUYBT-BOMYWPOKSA-N |
| XLogP | 6.45 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.45 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|