C28H31N3O5 — CID 23865025
[(E,1R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-phenylcarbamate (PubChem CID 23865025) has the molecular formula C28H31N3O5 and a molecular weight of 489.57 g/mol. Its IUPAC name is [(E,1R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-phenylcarbamate.
| Compound Name | [(E,1R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23865025 |
| Molecular Formula | C28H31N3O5 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.23 |
| IUPAC Name | [(E,1R)-5-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-phenylcarbamate |
| SMILES | CC(C)(/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccccc1)c1ccccc1OCCO |
| InChI | InChI=1S/C28H31N3O5/c1-28(2,17-16-25(33)31-23-14-8-7-13-22(23)29)26(21-12-6-9-15-24(21)35-19-18-32)36-27(34)30-20-10-4-3-5-11-20/h3-17,26,32H,18-19,29H2,1-2H3,(H,30,34)(H,31,33)/b17-16+/t26-/m0/s1 |
| InChIKey | HPSITNFEWIOQNQ-ZOGILVBSSA-N |
| XLogP | 5.15 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|