C29H33N3O6S — CID 23920905
[(E,1S,2S)-5-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23920905) has the molecular formula C29H33N3O6S and a molecular weight of 551.67 g/mol. Its IUPAC name is [(E,1S,2S)-5-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1S,2S)-5-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23920905 |
| Molecular Formula | C29H33N3O6S |
| Molecular Weight | 551.67 g/mol |
| Exact Mass | 551.21 |
| IUPAC Name | [(E,1S,2S)-5-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-5-oxopent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CCO[C@@H](/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccc(SC)cc1)c1ccccc1OCCO |
| InChI | InChI=1S/C29H33N3O6S/c1-3-36-26(16-17-27(34)32-24-10-6-5-9-23(24)30)28(22-8-4-7-11-25(22)37-19-18-33)38-29(35)31-20-12-14-21(39-2)15-13-20/h4-17,26,28,33H,3,18-19,30H2,1-2H3,(H,31,35)(H,32,34)/b17-16+/t26-,28-/m0/s1 |
| InChIKey | WVIYFFOTAHKOKA-ZUSZHNCHSA-N |
| XLogP | 5.25 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.67 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|