C30H34BrN3O6 — CID 23808115
[(E,1S,2S)-7-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23808115) has the molecular formula C30H34BrN3O6 and a molecular weight of 612.52 g/mol. Its IUPAC name is [(E,1S,2S)-7-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S,2S)-7-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23808115 |
| Molecular Formula | C30H34BrN3O6 |
| Molecular Weight | 612.52 g/mol |
| Exact Mass | 611.16 |
| IUPAC Name | [(E,1S,2S)-7-(2-aminoanilino)-2-ethoxy-1-[2-(2-hydroxyethoxy)phenyl]-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
| SMILES | CCO[C@@H](CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccccc1OCCO |
| InChI | InChI=1S/C30H34BrN3O6/c1-2-38-27(13-7-8-14-28(36)34-25-11-5-4-10-24(25)32)29(23-9-3-6-12-26(23)39-20-19-35)40-30(37)33-22-17-15-21(31)16-18-22/h3-6,8-12,14-18,27,29,35H,2,7,13,19-20,32H2,1H3,(H,33,37)(H,34,36)/b14-8+/t27-,29-/m0/s1 |
| InChIKey | PHRXBBPSIJYBAT-KVQQOXCQSA-N |
| XLogP | 6.07 |
| TPSA | 132.14 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.52 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|