C32H37N3O6 — CID 23976836
[(E,1R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate (PubChem CID 23976836) has the molecular formula C32H37N3O6 and a molecular weight of 559.66 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
|---|---|
| PubChem CID | 23976836 |
| Molecular Formula | C32H37N3O6 |
| Molecular Weight | 559.66 g/mol |
| Exact Mass | 559.27 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-[2-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-acetylphenyl)carbamate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@@H](c2ccccc2OCCO)C(C)(C)CC/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C32H37N3O6/c1-22(37)23-15-17-24(18-16-23)34-31(39)41-30(25-10-4-7-13-28(25)40-21-20-36)32(2,3)19-9-8-14-29(38)35-27-12-6-5-11-26(27)33/h4-8,10-18,30,36H,9,19-21,33H2,1-3H3,(H,34,39)(H,35,38)/b14-8+/t30-/m0/s1 |
| InChIKey | GDTUGPFAINVDMX-RVABBBBJSA-N |
| XLogP | 6.13 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.66 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|