C31H35N3O6 — CID 23921097
[(E,1R)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate (PubChem CID 23921097) has the molecular formula C31H35N3O6 and a molecular weight of 545.64 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate |
|---|---|
| PubChem CID | 23921097 |
| Molecular Formula | C31H35N3O6 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.25 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-benzoylcarbamate |
| SMILES | CC(C)(CC/C=C/C(=O)Nc1ccccc1N)[C@@H](OC(=O)NC(=O)c1ccccc1)c1ccc(OCCO)cc1 |
| InChI | InChI=1S/C31H35N3O6/c1-31(2,19-9-8-14-27(36)33-26-13-7-6-12-25(26)32)28(22-15-17-24(18-16-22)39-21-20-35)40-30(38)34-29(37)23-10-4-3-5-11-23/h3-8,10-18,28,35H,9,19-21,32H2,1-2H3,(H,33,36)(H,34,37,38)/b14-8+/t28-/m0/s1 |
| InChIKey | RVZLNESHBLUNSH-XFADDWSHSA-N |
| XLogP | 5.25 |
| TPSA | 139.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|