C25H32N2O6S — CID 23808284
[(E,1R)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23808284) has the molecular formula C25H32N2O6S and a molecular weight of 488.61 g/mol. Its IUPAC name is [(E,1R)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23808284 |
| Molecular Formula | C25H32N2O6S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.20 |
| IUPAC Name | [(E,1R)-7-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2ccc(OCCO)cc2)C(C)(C)CC/C=C/C(=O)NO)cc1 |
| InChI | InChI=1S/C25H32N2O6S/c1-25(2,15-5-4-6-22(29)27-31)23(18-7-11-20(12-8-18)32-17-16-28)33-24(30)26-19-9-13-21(34-3)14-10-19/h4,6-14,23,28,31H,5,15-17H2,1-3H3,(H,26,30)(H,27,29)/b6-4+/t23-/m0/s1 |
| InChIKey | OWWYNUKGNYSPSW-DOHLAZSCSA-N |
| XLogP | 4.94 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|