C27H28N2O7S — CID 23948907
[(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23948907) has the molecular formula C27H28N2O7S and a molecular weight of 524.60 g/mol. Its IUPAC name is [(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23948907 |
| Molecular Formula | C27H28N2O7S |
| Molecular Weight | 524.60 g/mol |
| Exact Mass | 524.16 |
| IUPAC Name | [(E,1R,2R)-5-(hydroxyamino)-1-[4-(2-hydroxyethoxy)phenyl]-5-oxo-2-phenoxypent-3-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@H](c2ccc(OCCO)cc2)[C@@H](/C=C/C(=O)NO)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H28N2O7S/c1-37-23-13-9-20(10-14-23)28-27(32)36-26(19-7-11-21(12-8-19)34-18-17-30)24(15-16-25(31)29-33)35-22-5-3-2-4-6-22/h2-16,24,26,30,33H,17-18H2,1H3,(H,28,32)(H,29,31)/b16-15+/t24-,26-/m1/s1 |
| InChIKey | DPKMXSFYRNYQCL-LZLHQAPRSA-N |
| XLogP | 4.58 |
| TPSA | 126.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.60 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|