C27H27NO7S — CID 23808157
(E,4R,5R)-5-[3-(2-hydroxyethoxy)phenyl]-5-[(4-methylsulfanylphenyl)carbamoyloxy]-4-phenoxypent-2-enoic acid (PubChem CID 23808157) has the molecular formula C27H27NO7S and a molecular weight of 509.58 g/mol. Its IUPAC name is (E,4R,5R)-5-[3-(2-hydroxyethoxy)phenyl]-5-[(4-methylsulfanylphenyl)carbamoyloxy]-4-phenoxypent-2-enoic acid.
| Compound Name | (E,4R,5R)-5-[3-(2-hydroxyethoxy)phenyl]-5-[(4-methylsulfanylphenyl)carbamoyloxy]-4-phenoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23808157 |
| Molecular Formula | C27H27NO7S |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (E,4R,5R)-5-[3-(2-hydroxyethoxy)phenyl]-5-[(4-methylsulfanylphenyl)carbamoyloxy]-4-phenoxypent-2-enoic acid |
| SMILES | CSc1ccc(NC(=O)O[C@H](c2cccc(OCCO)c2)[C@@H](/C=C/C(=O)O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C27H27NO7S/c1-36-23-12-10-20(11-13-23)28-27(32)35-26(19-6-5-9-22(18-19)33-17-16-29)24(14-15-25(30)31)34-21-7-3-2-4-8-21/h2-15,18,24,26,29H,16-17H2,1H3,(H,28,32)(H,30,31)/b15-14+/t24-,26-/m1/s1 |
| InChIKey | GMZRKOIBMPECLL-SPHZKDIRSA-N |
| XLogP | 5.16 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|