C20H20BrNO6 — CID 23750076
(E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]pent-2-enoic acid (PubChem CID 23750076) has the molecular formula C20H20BrNO6 and a molecular weight of 450.29 g/mol. Its IUPAC name is (E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]pent-2-enoic acid.
| Compound Name | (E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]pent-2-enoic acid |
|---|---|
| PubChem CID | 23750076 |
| Molecular Formula | C20H20BrNO6 |
| Molecular Weight | 450.29 g/mol |
| Exact Mass | 449.05 |
| IUPAC Name | (E,5R)-5-[(4-bromophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]pent-2-enoic acid |
| SMILES | O=C(O)/C=C/C[C@@H](OC(=O)Nc1ccc(Br)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C20H20BrNO6/c21-15-7-9-16(10-8-15)22-20(26)28-18(5-2-6-19(24)25)14-3-1-4-17(13-14)27-12-11-23/h1-4,6-10,13,18,23H,5,11-12H2,(H,22,26)(H,24,25)/b6-2+/t18-/m1/s1 |
| InChIKey | KLZXUGOFGSSNTO-OBNPVOHOSA-N |
| XLogP | 4.14 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.29 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|