C22H25BrN2O6 — CID 23976867
[(E,1S)-5-(hydroxyamino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23976867) has the molecular formula C22H25BrN2O6 and a molecular weight of 493.35 g/mol. Its IUPAC name is [(E,1S)-5-(hydroxyamino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1S)-5-(hydroxyamino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23976867 |
| Molecular Formula | C22H25BrN2O6 |
| Molecular Weight | 493.35 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | [(E,1S)-5-(hydroxyamino)-1-[3-(2-hydroxyethoxy)phenyl]-2,2-dimethyl-5-oxopent-3-enyl] N-(4-bromophenyl)carbamate |
| SMILES | CC(C)(/C=C/C(=O)NO)[C@H](OC(=O)Nc1ccc(Br)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C22H25BrN2O6/c1-22(2,11-10-19(27)25-29)20(15-4-3-5-18(14-15)30-13-12-26)31-21(28)24-17-8-6-16(23)7-9-17/h3-11,14,20,26,29H,12-13H2,1-2H3,(H,24,28)(H,25,27)/b11-10+/t20-/m1/s1 |
| InChIKey | FRSKXPANFZFUFU-CTDFXDFQSA-N |
| XLogP | 4.20 |
| TPSA | 117.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.35 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|