C23H24N2O6 — CID 23865109
(E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]-4,4-dimethylpent-2-enoic acid (PubChem CID 23865109) has the molecular formula C23H24N2O6 and a molecular weight of 424.45 g/mol. Its IUPAC name is (E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]-4,4-dimethylpent-2-enoic acid.
| Compound Name | (E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 23865109 |
| Molecular Formula | C23H24N2O6 |
| Molecular Weight | 424.45 g/mol |
| Exact Mass | 424.16 |
| IUPAC Name | (E,5R)-5-[(4-cyanophenyl)carbamoyloxy]-5-[3-(2-hydroxyethoxy)phenyl]-4,4-dimethylpent-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc(C#N)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C23H24N2O6/c1-23(2,11-10-20(27)28)21(17-4-3-5-19(14-17)30-13-12-26)31-22(29)25-18-8-6-16(15-24)7-9-18/h3-11,14,21,26H,12-13H2,1-2H3,(H,25,29)(H,27,28)/b11-10+/t21-/m0/s1 |
| InChIKey | RYOABFWPOPIJGW-ZJVMWOEPSA-N |
| XLogP | 3.89 |
| TPSA | 128.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|