C24H31NO6S — CID 23808124
[(4S)-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate (PubChem CID 23808124) has the molecular formula C24H31NO6S and a molecular weight of 461.58 g/mol. Its IUPAC name is [(4S)-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate.
| Compound Name | [(4S)-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23808124 |
| Molecular Formula | C24H31NO6S |
| Molecular Weight | 461.58 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | [(4S)-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethyl-4-[(4-methylphenyl)carbamoyloxy]butyl] 2-sulfanylacetate |
| SMILES | Cc1ccc(NC(=O)O[C@H](c2cccc(OCCO)c2)C(C)(C)CCOC(=O)CS)cc1 |
| InChI | InChI=1S/C24H31NO6S/c1-17-7-9-19(10-8-17)25-23(28)31-22(24(2,3)11-13-30-21(27)16-32)18-5-4-6-20(15-18)29-14-12-26/h4-10,15,22,26,32H,11-14,16H2,1-3H3,(H,25,28)/t22-/m1/s1 |
| InChIKey | GDXQPNPDFIGTMX-JOCHJYFZSA-N |
| XLogP | 4.55 |
| TPSA | 94.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.58 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|