C24H28N2O6S — CID 23920961
[(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethylbutyl] 2-sulfanylacetate (PubChem CID 23920961) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is [(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethylbutyl] 2-sulfanylacetate.
| Compound Name | [(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethylbutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23920961 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | [(4R)-4-[(4-cyanophenyl)carbamoyloxy]-4-[3-(2-hydroxyethoxy)phenyl]-3,3-dimethylbutyl] 2-sulfanylacetate |
| SMILES | CC(C)(CCOC(=O)CS)[C@@H](OC(=O)Nc1ccc(C#N)cc1)c1cccc(OCCO)c1 |
| InChI | InChI=1S/C24H28N2O6S/c1-24(2,10-12-31-21(28)16-33)22(18-4-3-5-20(14-18)30-13-11-27)32-23(29)26-19-8-6-17(15-25)7-9-19/h3-9,14,22,27,33H,10-13,16H2,1-2H3,(H,26,29)/t22-/m0/s1 |
| InChIKey | ZTJPVHFNPMQUGZ-QFIPXVFZSA-N |
| XLogP | 4.11 |
| TPSA | 117.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|