C23H26BrNO6S — CID 23778792
[(4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(5-bromo-2-hydroxyphenyl)-3,3-dimethylbutyl] 2-sulfanylacetate (PubChem CID 23778792) has the molecular formula C23H26BrNO6S and a molecular weight of 524.43 g/mol. Its IUPAC name is [(4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(5-bromo-2-hydroxyphenyl)-3,3-dimethylbutyl] 2-sulfanylacetate.
| Compound Name | [(4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(5-bromo-2-hydroxyphenyl)-3,3-dimethylbutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23778792 |
| Molecular Formula | C23H26BrNO6S |
| Molecular Weight | 524.43 g/mol |
| Exact Mass | 523.07 |
| IUPAC Name | [(4S)-4-[(4-acetylphenyl)carbamoyloxy]-4-(5-bromo-2-hydroxyphenyl)-3,3-dimethylbutyl] 2-sulfanylacetate |
| SMILES | CC(=O)c1ccc(NC(=O)O[C@H](c2cc(Br)ccc2O)C(C)(C)CCOC(=O)CS)cc1 |
| InChI | InChI=1S/C23H26BrNO6S/c1-14(26)15-4-7-17(8-5-15)25-22(29)31-21(18-12-16(24)6-9-19(18)27)23(2,3)10-11-30-20(28)13-32/h4-9,12,21,27,32H,10-11,13H2,1-3H3,(H,25,29)/t21-/m1/s1 |
| InChIKey | ISEMXNZHJHENOQ-OAQYLSRUSA-N |
| XLogP | 5.54 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.43 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|