C26H27NO6S — CID 23836376
[(4R)-4-(benzoylcarbamoyloxy)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethylbutyl] 2-sulfanylacetate (PubChem CID 23836376) has the molecular formula C26H27NO6S and a molecular weight of 481.57 g/mol. Its IUPAC name is [(4R)-4-(benzoylcarbamoyloxy)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethylbutyl] 2-sulfanylacetate.
| Compound Name | [(4R)-4-(benzoylcarbamoyloxy)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethylbutyl] 2-sulfanylacetate |
|---|---|
| PubChem CID | 23836376 |
| Molecular Formula | C26H27NO6S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.16 |
| IUPAC Name | [(4R)-4-(benzoylcarbamoyloxy)-4-(4-hydroxynaphthalen-1-yl)-3,3-dimethylbutyl] 2-sulfanylacetate |
| SMILES | CC(C)(CCOC(=O)CS)[C@@H](OC(=O)NC(=O)c1ccccc1)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C26H27NO6S/c1-26(2,14-15-32-22(29)16-34)23(20-12-13-21(28)19-11-7-6-10-18(19)20)33-25(31)27-24(30)17-8-4-3-5-9-17/h3-13,23,28,34H,14-16H2,1-2H3,(H,27,30,31)/t23-/m0/s1 |
| InChIKey | UYPVUWBSXJSQGK-QHCPKHFHSA-N |
| XLogP | 5.04 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|