C19H22INO4 — CID 23948476
[(1S)-4-hydroxy-1-(2-hydroxy-5-iodophenyl)-2,2-dimethylbutyl] N-phenylcarbamate (PubChem CID 23948476) has the molecular formula C19H22INO4 and a molecular weight of 455.29 g/mol. Its IUPAC name is [(1S)-4-hydroxy-1-(2-hydroxy-5-iodophenyl)-2,2-dimethylbutyl] N-phenylcarbamate.
| Compound Name | [(1S)-4-hydroxy-1-(2-hydroxy-5-iodophenyl)-2,2-dimethylbutyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23948476 |
| Molecular Formula | C19H22INO4 |
| Molecular Weight | 455.29 g/mol |
| Exact Mass | 455.06 |
| IUPAC Name | [(1S)-4-hydroxy-1-(2-hydroxy-5-iodophenyl)-2,2-dimethylbutyl] N-phenylcarbamate |
| SMILES | CC(C)(CCO)[C@H](OC(=O)Nc1ccccc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C19H22INO4/c1-19(2,10-11-22)17(15-12-13(20)8-9-16(15)23)25-18(24)21-14-6-4-3-5-7-14/h3-9,12,17,22-23H,10-11H2,1-2H3,(H,21,24)/t17-/m1/s1 |
| InChIKey | NUYKXVJAGLKYQS-QGZVFWFLSA-N |
| XLogP | 4.70 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.29 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|