C20H20BrNO5 — CID 23836490
(E,5R)-5-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-5-(phenylcarbamoyloxy)pent-2-enoic acid (PubChem CID 23836490) has the molecular formula C20H20BrNO5 and a molecular weight of 434.29 g/mol. Its IUPAC name is (E,5R)-5-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-5-(phenylcarbamoyloxy)pent-2-enoic acid.
| Compound Name | (E,5R)-5-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-5-(phenylcarbamoyloxy)pent-2-enoic acid |
|---|---|
| PubChem CID | 23836490 |
| Molecular Formula | C20H20BrNO5 |
| Molecular Weight | 434.29 g/mol |
| Exact Mass | 433.05 |
| IUPAC Name | (E,5R)-5-(5-bromo-2-hydroxyphenyl)-4,4-dimethyl-5-(phenylcarbamoyloxy)pent-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccccc1)c1cc(Br)ccc1O |
| InChI | InChI=1S/C20H20BrNO5/c1-20(2,11-10-17(24)25)18(15-12-13(21)8-9-16(15)23)27-19(26)22-14-6-4-3-5-7-14/h3-12,18,23H,1-2H3,(H,22,26)(H,24,25)/b11-10+/t18-/m0/s1 |
| InChIKey | BTCZJHOAJQEMPG-ZGKFYVQTSA-N |
| XLogP | 5.11 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.29 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|