C21H22INO5S — CID 23920696
(E,5R)-5-(2-hydroxy-5-iodophenyl)-4,4-dimethyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid (PubChem CID 23920696) has the molecular formula C21H22INO5S and a molecular weight of 527.38 g/mol. Its IUPAC name is (E,5R)-5-(2-hydroxy-5-iodophenyl)-4,4-dimethyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid.
| Compound Name | (E,5R)-5-(2-hydroxy-5-iodophenyl)-4,4-dimethyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
|---|---|
| PubChem CID | 23920696 |
| Molecular Formula | C21H22INO5S |
| Molecular Weight | 527.38 g/mol |
| Exact Mass | 527.03 |
| IUPAC Name | (E,5R)-5-(2-hydroxy-5-iodophenyl)-4,4-dimethyl-5-[(4-methylsulfanylphenyl)carbamoyloxy]pent-2-enoic acid |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2cc(I)ccc2O)C(C)(C)/C=C/C(=O)O)cc1 |
| InChI | InChI=1S/C21H22INO5S/c1-21(2,11-10-18(25)26)19(16-12-13(22)4-9-17(16)24)28-20(27)23-14-5-7-15(29-3)8-6-14/h4-12,19,24H,1-3H3,(H,23,27)(H,25,26)/b11-10+/t19-/m0/s1 |
| InChIKey | VQUSFWXCNJSZNZ-VYENPZKTSA-N |
| XLogP | 5.68 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.38 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|