C25H23NO7 — CID 23976430
(E,5R)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)-4,4-dimethylpent-2-enoic acid (PubChem CID 23976430) has the molecular formula C25H23NO7 and a molecular weight of 449.46 g/mol. Its IUPAC name is (E,5R)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)-4,4-dimethylpent-2-enoic acid.
| Compound Name | (E,5R)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)-4,4-dimethylpent-2-enoic acid |
|---|---|
| PubChem CID | 23976430 |
| Molecular Formula | C25H23NO7 |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.15 |
| IUPAC Name | (E,5R)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)-4,4-dimethylpent-2-enoic acid |
| SMILES | CC(C)(/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C25H23NO7/c1-25(2,12-11-22(28)29)23(18-8-9-19(27)17-6-4-3-5-16(17)18)33-24(30)26-15-7-10-20-21(13-15)32-14-31-20/h3-13,23,27H,14H2,1-2H3,(H,26,30)(H,28,29)/b12-11+/t23-/m0/s1 |
| InChIKey | GFIWIGNNDSSCQU-RGPPVUSESA-N |
| XLogP | 5.23 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|