C20H19NO8 — CID 23864948
(E,4S,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid (PubChem CID 23864948) has the molecular formula C20H19NO8 and a molecular weight of 401.37 g/mol. Its IUPAC name is (E,4S,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid.
| Compound Name | (E,4S,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid |
|---|---|
| PubChem CID | 23864948 |
| Molecular Formula | C20H19NO8 |
| Molecular Weight | 401.37 g/mol |
| Exact Mass | 401.11 |
| IUPAC Name | (E,4S,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxyphenyl)-4-methoxypent-2-enoic acid |
| SMILES | CO[C@@H](/C=C/C(=O)O)[C@@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(O)cc1 |
| InChI | InChI=1S/C20H19NO8/c1-26-16(8-9-18(23)24)19(12-2-5-14(22)6-3-12)29-20(25)21-13-4-7-15-17(10-13)28-11-27-15/h2-10,16,19,22H,11H2,1H3,(H,21,25)(H,23,24)/b9-8+/t16-,19-/m0/s1 |
| InChIKey | SVNUHXTYCLFBJE-XERWZBGXSA-N |
| XLogP | 3.07 |
| TPSA | 123.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|