C23H19NO7 — CID 23948300
(E,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)pent-2-enoic acid (PubChem CID 23948300) has the molecular formula C23H19NO7 and a molecular weight of 421.41 g/mol. Its IUPAC name is (E,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)pent-2-enoic acid.
| Compound Name | (E,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)pent-2-enoic acid |
|---|---|
| PubChem CID | 23948300 |
| Molecular Formula | C23H19NO7 |
| Molecular Weight | 421.41 g/mol |
| Exact Mass | 421.12 |
| IUPAC Name | (E,5S)-5-(1,3-benzodioxol-5-ylcarbamoyloxy)-5-(4-hydroxynaphthalen-1-yl)pent-2-enoic acid |
| SMILES | O=C(O)/C=C/C[C@H](OC(=O)Nc1ccc2c(c1)OCO2)c1ccc(O)c2ccccc12 |
| InChI | InChI=1S/C23H19NO7/c25-18-10-9-17(15-4-1-2-5-16(15)18)19(6-3-7-22(26)27)31-23(28)24-14-8-11-20-21(12-14)30-13-29-20/h1-5,7-12,19,25H,6,13H2,(H,24,28)(H,26,27)/b7-3+/t19-/m0/s1 |
| InChIKey | ZPEFDLQYSNWFAL-CZXUKVBWSA-N |
| XLogP | 4.59 |
| TPSA | 114.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|