C18H18N2O4 — CID 108946171
N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-methylpropanediamide (PubChem CID 108946171) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-methylpropanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-methylpropanediamide |
|---|---|
| PubChem CID | 108946171 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-methylpropanediamide |
| SMILES | CN(Cc1ccccc1)C(=O)CC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18N2O4/c1-20(11-13-5-3-2-4-6-13)18(22)10-17(21)19-14-7-8-15-16(9-14)24-12-23-15/h2-9H,10-12H2,1H3,(H,19,21) |
| InChIKey | YXSMKVXMDDSFBG-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|