C29H26N2O3 — CID 94233315
(2R)-N-(1,3-benzodioxol-5-yl)-2-(dibenzylamino)-2-phenylacetamide (PubChem CID 94233315) has the molecular formula C29H26N2O3 and a molecular weight of 450.54 g/mol. Its IUPAC name is (2R)-N-(1,3-benzodioxol-5-yl)-2-(dibenzylamino)-2-phenylacetamide.
| Compound Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(dibenzylamino)-2-phenylacetamide |
|---|---|
| PubChem CID | 94233315 |
| Molecular Formula | C29H26N2O3 |
| Molecular Weight | 450.54 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (2R)-N-(1,3-benzodioxol-5-yl)-2-(dibenzylamino)-2-phenylacetamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)[C@@H](c1ccccc1)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C29H26N2O3/c32-29(30-25-16-17-26-27(18-25)34-21-33-26)28(24-14-8-3-9-15-24)31(19-22-10-4-1-5-11-22)20-23-12-6-2-7-13-23/h1-18,28H,19-21H2,(H,30,32)/t28-/m1/s1 |
| InChIKey | LKESHJOGBTVARD-MUUNZHRXSA-N |
| XLogP | 5.80 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.54 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |