C22H18N2O4 — CID 108528257
N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-phenyloxamide (PubChem CID 108528257) has the molecular formula C22H18N2O4 and a molecular weight of 374.40 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-phenyloxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-phenyloxamide |
|---|---|
| PubChem CID | 108528257 |
| Molecular Formula | C22H18N2O4 |
| Molecular Weight | 374.40 g/mol |
| Exact Mass | 374.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-phenyloxamide |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C22H18N2O4/c25-21(23-17-11-12-19-20(13-17)28-15-27-19)22(26)24(18-9-5-2-6-10-18)14-16-7-3-1-4-8-16/h1-13H,14-15H2,(H,23,25) |
| InChIKey | NFHVKGFYVBZAOL-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|