About N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide
N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide (PubChem CID 108987656) has the molecular formula C22H17N3O2
and a molecular weight of 355.40 g/mol. Its IUPAC name is N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide.
Molecular Properties
| Compound Name | N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide |
| PubChem CID | 108987656 |
| Molecular Formula | C22H17N3O2 |
| Molecular Weight | 355.40 g/mol |
| Exact Mass | 355.13 |
| IUPAC Name | N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide |
| SMILES | N#Cc1cccc(NC(=O)C(=O)N(Cc2ccccc2)c2ccccc2)c1 |
| InChI | InChI=1S/C22H17N3O2/c23-15-18-10-7-11-19(14-18)24-21(26)22(27)25(20-12-5-2-6-13-20)16-17-8-3-1-4-9-17/h1-14H,16H2,(H,24,26) |
| InChIKey | AUZSAANGNSWYOO-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.40 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide?
The IUPAC name of N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide (CID 108987656) is N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide.
What is the SMILES notation for N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide?
The canonical SMILES for N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide is N#Cc1cccc(NC(=O)C(=O)N(Cc2ccccc2)c2ccccc2)c1.
What is the InChIKey of N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide?
The InChIKey is AUZSAANGNSWYOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N3O2/c23-15-18-10-7-11-19(14-18)24-21(26)22(27)25(20-12-5-2-6-13-20)16-17-8-3-1-4-9-17/h1-14H,16H2,(H,24,26).
What are the key properties of N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide?
N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide has a molecular weight of 355.40 g/mol, XLogP of 3.73, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-(3-cyanophenyl)-N'-phenyloxamide is sourced from PubChem (CID 108987656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).