About N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide
N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide (PubChem CID 108986775) has the molecular formula C16H13N3O2
and a molecular weight of 279.30 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide |
| PubChem CID | 108986775 |
| Molecular Formula | C16H13N3O2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.10 |
| IUPAC Name | N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide |
| SMILES | CN(C(=O)C(=O)Nc1cccc(C#N)c1)c1ccccc1 |
| InChI | InChI=1S/C16H13N3O2/c1-19(14-8-3-2-4-9-14)16(21)15(20)18-13-7-5-6-12(10-13)11-17/h2-10H,1H3,(H,18,20) |
| InChIKey | UVNJILMYPBMCGB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 73.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide?
The IUPAC name of N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide (CID 108986775) is N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide.
What is the SMILES notation for N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide?
The canonical SMILES for N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide is CN(C(=O)C(=O)Nc1cccc(C#N)c1)c1ccccc1.
What is the InChIKey of N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide?
The InChIKey is UVNJILMYPBMCGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3O2/c1-19(14-8-3-2-4-9-14)16(21)15(20)18-13-7-5-6-12(10-13)11-17/h2-10H,1H3,(H,18,20).
What are the key properties of N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide?
N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide has a molecular weight of 279.30 g/mol, XLogP of 2.16, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-cyanophenyl)-N'-methyl-N'-phenyloxamide is sourced from PubChem (CID 108986775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).