About N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide
N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide (PubChem CID 108516639) has the molecular formula C21H17ClN2O2
and a molecular weight of 364.83 g/mol. Its IUPAC name is N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide.
Molecular Properties
| Compound Name | N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide |
| PubChem CID | 108516639 |
| Molecular Formula | C21H17ClN2O2 |
| Molecular Weight | 364.83 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)C(=O)N(Cc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H17ClN2O2/c22-17-11-13-18(14-12-17)23-20(25)21(26)24(19-9-5-2-6-10-19)15-16-7-3-1-4-8-16/h1-14H,15H2,(H,23,25) |
| InChIKey | JUQVUKJEVZMTQF-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.83 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide?
The IUPAC name of N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide (CID 108516639) is N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide.
What is the SMILES notation for N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide?
The canonical SMILES for N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide is O=C(Nc1ccc(Cl)cc1)C(=O)N(Cc1ccccc1)c1ccccc1.
What is the InChIKey of N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide?
The InChIKey is JUQVUKJEVZMTQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17ClN2O2/c22-17-11-13-18(14-12-17)23-20(25)21(26)24(19-9-5-2-6-10-19)15-16-7-3-1-4-8-16/h1-14H,15H2,(H,23,25).
What are the key properties of N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide?
N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide has a molecular weight of 364.83 g/mol, XLogP of 4.51, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-benzyl-N-(4-chlorophenyl)-N'-phenyloxamide is sourced from PubChem (CID 108516639), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).