C18H18N2O4 — CID 108986912
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-phenyloxamide (PubChem CID 108986912) has the molecular formula C18H18N2O4 and a molecular weight of 326.35 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-phenyloxamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-phenyloxamide |
|---|---|
| PubChem CID | 108986912 |
| Molecular Formula | C18H18N2O4 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-N'-ethyl-N'-phenyloxamide |
| SMILES | CCN(C(=O)C(=O)Nc1ccc2c(c1)OCCO2)c1ccccc1 |
| InChI | InChI=1S/C18H18N2O4/c1-2-20(14-6-4-3-5-7-14)18(22)17(21)19-13-8-9-15-16(12-13)24-11-10-23-15/h3-9,12H,2,10-11H2,1H3,(H,19,21) |
| InChIKey | SWVDPOMEMBLZLH-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|