C23H27N3O5 — CID 43814830
N'-benzyl-N'-[2-(tert-butylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide (PubChem CID 43814830) has the molecular formula C23H27N3O5 and a molecular weight of 425.49 g/mol. Its IUPAC name is N'-benzyl-N'-[2-(tert-butylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide.
| Compound Name | N'-benzyl-N'-[2-(tert-butylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide |
|---|---|
| PubChem CID | 43814830 |
| Molecular Formula | C23H27N3O5 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | N'-benzyl-N'-[2-(tert-butylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide |
| SMILES | CC(C)(C)NC(=O)CN(Cc1ccccc1)C(=O)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C23H27N3O5/c1-23(2,3)25-20(27)15-26(14-16-7-5-4-6-8-16)22(29)21(28)24-17-9-10-18-19(13-17)31-12-11-30-18/h4-10,13H,11-12,14-15H2,1-3H3,(H,24,28)(H,25,27) |
| InChIKey | SVPYAQHFZPSIIE-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|