C24H27N3O5 — CID 43814851
N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-[2-(cyclohexylamino)-2-oxoethyl]oxamide (PubChem CID 43814851) has the molecular formula C24H27N3O5 and a molecular weight of 437.50 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-[2-(cyclohexylamino)-2-oxoethyl]oxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-[2-(cyclohexylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 43814851 |
| Molecular Formula | C24H27N3O5 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.20 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-benzyl-N'-[2-(cyclohexylamino)-2-oxoethyl]oxamide |
| SMILES | O=C(CN(Cc1ccccc1)C(=O)C(=O)Nc1ccc2c(c1)OCO2)NC1CCCCC1 |
| InChI | InChI=1S/C24H27N3O5/c28-22(25-18-9-5-2-6-10-18)15-27(14-17-7-3-1-4-8-17)24(30)23(29)26-19-11-12-20-21(13-19)32-16-31-20/h1,3-4,7-8,11-13,18H,2,5-6,9-10,14-16H2,(H,25,28)(H,26,29) |
| InChIKey | SPANJUNDTTZARA-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|