C21H29N3O5 — CID 3221300
N'-butyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide (PubChem CID 3221300) has the molecular formula C21H29N3O5 and a molecular weight of 403.48 g/mol. Its IUPAC name is N'-butyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide.
| Compound Name | N'-butyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide |
|---|---|
| PubChem CID | 3221300 |
| Molecular Formula | C21H29N3O5 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | N'-butyl-N'-[2-(cyclopentylamino)-2-oxoethyl]-N-(2,3-dihydro-1,4-benzodioxin-6-yl)oxamide |
| SMILES | CCCCN(CC(=O)NC1CCCC1)C(=O)C(=O)Nc1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C21H29N3O5/c1-2-3-10-24(14-19(25)22-15-6-4-5-7-15)21(27)20(26)23-16-8-9-17-18(13-16)29-12-11-28-17/h8-9,13,15H,2-7,10-12,14H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | JWWXNUKCJCVFSY-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 96.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|