C18H23N3O5 — CID 17412060
N'-cyclopentyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl]oxamide (PubChem CID 17412060) has the molecular formula C18H23N3O5 and a molecular weight of 361.40 g/mol. Its IUPAC name is N'-cyclopentyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl]oxamide.
| Compound Name | N'-cyclopentyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl]oxamide |
|---|---|
| PubChem CID | 17412060 |
| Molecular Formula | C18H23N3O5 |
| Molecular Weight | 361.40 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | N'-cyclopentyl-N-[2-(3,4-dihydro-2H-1,5-benzodioxepin-7-ylamino)-2-oxoethyl]oxamide |
| SMILES | O=C(CNC(=O)C(=O)NC1CCCC1)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C18H23N3O5/c22-16(11-19-17(23)18(24)21-12-4-1-2-5-12)20-13-6-7-14-15(10-13)26-9-3-8-25-14/h6-7,10,12H,1-5,8-9,11H2,(H,19,23)(H,20,22)(H,21,24) |
| InChIKey | XWICHYMIRIAFRP-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.40 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|