C20H28N2O4 — CID 108966151
N-cycloheptyl-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpropanediamide (PubChem CID 108966151) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is N-cycloheptyl-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpropanediamide.
| Compound Name | N-cycloheptyl-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108966151 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | N-cycloheptyl-N'-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc2c(c1)OCCO2)C(=O)NC1CCCCCC1 |
| InChI | InChI=1S/C20H28N2O4/c1-20(2,18(23)21-14-7-5-3-4-6-8-14)19(24)22-15-9-10-16-17(13-15)26-12-11-25-16/h9-10,13-14H,3-8,11-12H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | ASZSRQFJQVOUMM-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|