C22H21N3O4 — CID 108970022
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethyl-N'-quinolin-8-ylpropanediamide (PubChem CID 108970022) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethyl-N'-quinolin-8-ylpropanediamide.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethyl-N'-quinolin-8-ylpropanediamide |
|---|---|
| PubChem CID | 108970022 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2,2-dimethyl-N'-quinolin-8-ylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc2c(c1)OCCO2)C(=O)Nc1cccc2cccnc12 |
| InChI | InChI=1S/C22H21N3O4/c1-22(2,20(26)24-15-8-9-17-18(13-15)29-12-11-28-17)21(27)25-16-7-3-5-14-6-4-10-23-19(14)16/h3-10,13H,11-12H2,1-2H3,(H,24,26)(H,25,27) |
| InChIKey | UYFWVZVCRQCFTN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|