C18H16Cl2N2O4 — CID 108970011
N-(1,3-benzodioxol-5-yl)-N'-(2,3-dichlorophenyl)-2,2-dimethylpropanediamide (PubChem CID 108970011) has the molecular formula C18H16Cl2N2O4 and a molecular weight of 395.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(2,3-dichlorophenyl)-2,2-dimethylpropanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(2,3-dichlorophenyl)-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108970011 |
| Molecular Formula | C18H16Cl2N2O4 |
| Molecular Weight | 395.24 g/mol |
| Exact Mass | 394.05 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(2,3-dichlorophenyl)-2,2-dimethylpropanediamide |
| SMILES | CC(C)(C(=O)Nc1ccc2c(c1)OCO2)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C18H16Cl2N2O4/c1-18(2,17(24)22-12-5-3-4-11(19)15(12)20)16(23)21-10-6-7-13-14(8-10)26-9-25-13/h3-8H,9H2,1-2H3,(H,21,23)(H,22,24) |
| InChIKey | FEMLJRIFNRJFQU-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.24 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|