C19H20N2O4 — CID 108967602
N-(1,3-benzodioxol-5-yl)-N',2,2-trimethyl-N'-phenylpropanediamide (PubChem CID 108967602) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N',2,2-trimethyl-N'-phenylpropanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N',2,2-trimethyl-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 108967602 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N',2,2-trimethyl-N'-phenylpropanediamide |
| SMILES | CN(C(=O)C(C)(C)C(=O)Nc1ccc2c(c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C19H20N2O4/c1-19(2,18(23)21(3)14-7-5-4-6-8-14)17(22)20-13-9-10-15-16(11-13)25-12-24-15/h4-11H,12H2,1-3H3,(H,20,22) |
| InChIKey | GYGIXYSWGIQLDO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|