C26H27IN2O5 — CID 23920693
[(E,1R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate (PubChem CID 23920693) has the molecular formula C26H27IN2O5 and a molecular weight of 574.42 g/mol. Its IUPAC name is [(E,1R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate.
| Compound Name | [(E,1R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
|---|---|
| PubChem CID | 23920693 |
| Molecular Formula | C26H27IN2O5 |
| Molecular Weight | 574.42 g/mol |
| Exact Mass | 574.10 |
| IUPAC Name | [(E,1R)-7-(hydroxyamino)-1-(2-hydroxy-5-iodophenyl)-2,2-dimethyl-7-oxohept-5-enyl] N-naphthalen-1-ylcarbamate |
| SMILES | CC(C)(CC/C=C/C(=O)NO)[C@@H](OC(=O)Nc1cccc2ccccc12)c1cc(I)ccc1O |
| InChI | InChI=1S/C26H27IN2O5/c1-26(2,15-6-5-12-23(31)29-33)24(20-16-18(27)13-14-22(20)30)34-25(32)28-21-11-7-9-17-8-3-4-10-19(17)21/h3-5,7-14,16,24,30,33H,6,15H2,1-2H3,(H,28,32)(H,29,31)/b12-5+/t24-/m0/s1 |
| InChIKey | CNZAUDGQMWKBAU-RYXQVQKZSA-N |
| XLogP | 6.31 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.42 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|