C22H24BrFN2O5 — CID 23892688
[(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2,2-dimethyl-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate (PubChem CID 23892688) has the molecular formula C22H24BrFN2O5 and a molecular weight of 495.35 g/mol. Its IUPAC name is [(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2,2-dimethyl-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate.
| Compound Name | [(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2,2-dimethyl-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
|---|---|
| PubChem CID | 23892688 |
| Molecular Formula | C22H24BrFN2O5 |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 494.09 |
| IUPAC Name | [(E,1R)-1-(3-fluoro-4-hydroxyphenyl)-7-(hydroxyamino)-2,2-dimethyl-7-oxohept-5-enyl] N-(4-bromophenyl)carbamate |
| SMILES | CC(C)(CC/C=C/C(=O)NO)[C@@H](OC(=O)Nc1ccc(Br)cc1)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C22H24BrFN2O5/c1-22(2,12-4-3-5-19(28)26-30)20(14-6-11-18(27)17(24)13-14)31-21(29)25-16-9-7-15(23)8-10-16/h3,5-11,13,20,27,30H,4,12H2,1-2H3,(H,25,29)(H,26,28)/b5-3+/t20-/m0/s1 |
| InChIKey | SUJYSZCXTNIHSG-GECPCNCSSA-N |
| XLogP | 5.45 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|