C11H12FNO4 — CID 23920385
(E,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxypent-2-enamide (PubChem CID 23920385) has the molecular formula C11H12FNO4 and a molecular weight of 241.22 g/mol. Its IUPAC name is (E,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxypent-2-enamide.
| Compound Name | (E,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxypent-2-enamide |
|---|---|
| PubChem CID | 23920385 |
| Molecular Formula | C11H12FNO4 |
| Molecular Weight | 241.22 g/mol |
| Exact Mass | 241.08 |
| IUPAC Name | (E,5S)-5-(3-fluoro-4-hydroxyphenyl)-N,5-dihydroxypent-2-enamide |
| SMILES | O=C(/C=C/C[C@H](O)c1ccc(O)c(F)c1)NO |
| InChI | InChI=1S/C11H12FNO4/c12-8-6-7(4-5-10(8)15)9(14)2-1-3-11(16)13-17/h1,3-6,9,14-15,17H,2H2,(H,13,16)/b3-1+/t9-/m0/s1 |
| InChIKey | FYWLXOXYNOGAAT-ARLXTTGXSA-N |
| XLogP | 1.02 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.22 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|