C13H16BrNO4 — CID 23864522
(E,7S)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxyhept-2-enamide (PubChem CID 23864522) has the molecular formula C13H16BrNO4 and a molecular weight of 330.18 g/mol. Its IUPAC name is (E,7S)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxyhept-2-enamide.
| Compound Name | (E,7S)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxyhept-2-enamide |
|---|---|
| PubChem CID | 23864522 |
| Molecular Formula | C13H16BrNO4 |
| Molecular Weight | 330.18 g/mol |
| Exact Mass | 329.03 |
| IUPAC Name | (E,7S)-7-(5-bromo-2-hydroxyphenyl)-N,7-dihydroxyhept-2-enamide |
| SMILES | O=C(/C=C/CCC[C@H](O)c1cc(Br)ccc1O)NO |
| InChI | InChI=1S/C13H16BrNO4/c14-9-6-7-12(17)10(8-9)11(16)4-2-1-3-5-13(18)15-19/h3,5-8,11,16-17,19H,1-2,4H2,(H,15,18)/b5-3+/t11-/m0/s1 |
| InChIKey | DVNSHUTVZIWSBX-TZNOJPMFSA-N |
| XLogP | 2.42 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.18 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|