C9H10BrNO4 — CID 71721725
3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide (PubChem CID 71721725) has the molecular formula C9H10BrNO4 and a molecular weight of 276.09 g/mol. Its IUPAC name is 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide.
| Compound Name | 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide |
|---|---|
| PubChem CID | 71721725 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide |
| SMILES | O=C(CC(O)c1cc(Br)ccc1O)NO |
| InChI | InChI=1S/C9H10BrNO4/c10-5-1-2-7(12)6(3-5)8(13)4-9(14)11-15/h1-3,8,12-13,15H,4H2,(H,11,14) |
| InChIKey | SSGOYCQTCIKAIL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|