About 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide
3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide (PubChem CID 71721725) has the molecular formula C9H10BrNO4
and a molecular weight of 276.09 g/mol. Its IUPAC name is 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide.
Molecular Properties
| Compound Name | 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide |
| PubChem CID | 71721725 |
| Molecular Formula | C9H10BrNO4 |
| Molecular Weight | 276.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide |
| SMILES | O=C(CC(O)c1cc(Br)ccc1O)NO |
| InChI | InChI=1S/C9H10BrNO4/c10-5-1-2-7(12)6(3-5)8(13)4-9(14)11-15/h1-3,8,12-13,15H,4H2,(H,11,14) |
| InChIKey | SSGOYCQTCIKAIL-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.09 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide?
The IUPAC name of 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide (CID 71721725) is 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide.
What is the SMILES notation for 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide?
The canonical SMILES for 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide is O=C(CC(O)c1cc(Br)ccc1O)NO.
What is the InChIKey of 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide?
The InChIKey is SSGOYCQTCIKAIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10BrNO4/c10-5-1-2-7(12)6(3-5)8(13)4-9(14)11-15/h1-3,8,12-13,15H,4H2,(H,11,14).
What are the key properties of 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide?
3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide has a molecular weight of 276.09 g/mol, XLogP of 1.08, 3 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-bromo-2-hydroxyphenyl)-N,3-dihydroxypropanamide is sourced from PubChem (CID 71721725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).