C27H25BrN4O4 — CID 23920637
[(E,1R)-7-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate (PubChem CID 23920637) has the molecular formula C27H25BrN4O4 and a molecular weight of 549.43 g/mol. Its IUPAC name is [(E,1R)-7-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate.
| Compound Name | [(E,1R)-7-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
|---|---|
| PubChem CID | 23920637 |
| Molecular Formula | C27H25BrN4O4 |
| Molecular Weight | 549.43 g/mol |
| Exact Mass | 548.11 |
| IUPAC Name | [(E,1R)-7-(2-aminoanilino)-1-(5-bromo-2-hydroxyphenyl)-7-oxohept-5-enyl] N-(4-cyanophenyl)carbamate |
| SMILES | N#Cc1ccc(NC(=O)O[C@H](CCC/C=C/C(=O)Nc2ccccc2N)c2cc(Br)ccc2O)cc1 |
| InChI | InChI=1S/C27H25BrN4O4/c28-19-12-15-24(33)21(16-19)25(36-27(35)31-20-13-10-18(17-29)11-14-20)8-2-1-3-9-26(34)32-23-7-5-4-6-22(23)30/h3-7,9-16,25,33H,1-2,8,30H2,(H,31,35)(H,32,34)/b9-3+/t25-/m1/s1 |
| InChIKey | MLQUTQOPOZXECX-FVEAESEPSA-N |
| XLogP | 6.26 |
| TPSA | 137.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.43 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|