C26H26IN3O4 — CID 23807856
[(E,1S)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-phenylcarbamate (PubChem CID 23807856) has the molecular formula C26H26IN3O4 and a molecular weight of 571.42 g/mol. Its IUPAC name is [(E,1S)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-phenylcarbamate.
| Compound Name | [(E,1S)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-phenylcarbamate |
|---|---|
| PubChem CID | 23807856 |
| Molecular Formula | C26H26IN3O4 |
| Molecular Weight | 571.42 g/mol |
| Exact Mass | 571.10 |
| IUPAC Name | [(E,1S)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-7-oxohept-5-enyl] N-phenylcarbamate |
| SMILES | Nc1ccccc1NC(=O)/C=C/CCC[C@H](OC(=O)Nc1ccccc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C26H26IN3O4/c27-18-15-16-23(31)20(17-18)24(34-26(33)29-19-9-3-1-4-10-19)13-5-2-6-14-25(32)30-22-12-8-7-11-21(22)28/h1,3-4,6-12,14-17,24,31H,2,5,13,28H2,(H,29,33)(H,30,32)/b14-6+/t24-/m0/s1 |
| InChIKey | BBOGNCUCKBLCLW-YVTXKPHZSA-N |
| XLogP | 6.23 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.42 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|