C28H30IN3O5S — CID 23836534
[(E,1R,2R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23836534) has the molecular formula C28H30IN3O5S and a molecular weight of 647.54 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23836534 |
| Molecular Formula | C28H30IN3O5S |
| Molecular Weight | 647.54 g/mol |
| Exact Mass | 647.10 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(2-hydroxy-5-iodophenyl)-2-methoxy-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CO[C@H](CC/C=C/C(=O)Nc1ccccc1N)[C@H](OC(=O)Nc1ccc(SC)cc1)c1cc(I)ccc1O |
| InChI | InChI=1S/C28H30IN3O5S/c1-36-25(9-5-6-10-26(34)32-23-8-4-3-7-22(23)30)27(21-17-18(29)11-16-24(21)33)37-28(35)31-19-12-14-20(38-2)15-13-19/h3-4,6-8,10-17,25,27,33H,5,9,30H2,1-2H3,(H,31,35)(H,32,34)/b10-6+/t25-,27-/m1/s1 |
| InChIKey | SEDKVRXMPODYMQ-HWYLJLLPSA-N |
| XLogP | 6.58 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.54 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|