C28H30FN3O4S — CID 23864884
[(E,1R,2S)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23864884) has the molecular formula C28H30FN3O4S and a molecular weight of 523.63 g/mol. Its IUPAC name is [(E,1R,2S)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R,2S)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23864884 |
| Molecular Formula | C28H30FN3O4S |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.19 |
| IUPAC Name | [(E,1R,2S)-7-(2-aminoanilino)-1-(3-fluoro-4-hydroxyphenyl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2ccc(O)c(F)c2)[C@@H](C)CC/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C28H30FN3O4S/c1-18(7-3-6-10-26(34)32-24-9-5-4-8-23(24)30)27(19-11-16-25(33)22(29)17-19)36-28(35)31-20-12-14-21(37-2)15-13-20/h4-6,8-18,27,33H,3,7,30H2,1-2H3,(H,31,35)(H,32,34)/b10-6+/t18-,27+/m0/s1 |
| InChIKey | TZSGZVRAWDYYMF-LGXWJSCPSA-N |
| XLogP | 6.74 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|