C32H33N3O4S — CID 23892441
[(E,1R,2R)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23892441) has the molecular formula C32H33N3O4S and a molecular weight of 555.70 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23892441 |
| Molecular Formula | C32H33N3O4S |
| Molecular Weight | 555.70 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(4-hydroxynaphthalen-1-yl)-2-methyl-7-oxohept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@@H](c2ccc(O)c3ccccc23)[C@H](C)CC/C=C/C(=O)Nc2ccccc2N)cc1 |
| InChI | InChI=1S/C32H33N3O4S/c1-21(9-3-8-14-30(37)35-28-13-7-6-12-27(28)33)31(26-19-20-29(36)25-11-5-4-10-24(25)26)39-32(38)34-22-15-17-23(40-2)18-16-22/h4-8,10-21,31,36H,3,9,33H2,1-2H3,(H,34,38)(H,35,37)/b14-8+/t21-,31-/m1/s1 |
| InChIKey | WJMQRENFDBIRPP-OKDJGPMNSA-N |
| XLogP | 7.75 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.70 |
| LogP ≤ 5 | 7.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|