C33H31Br2N3O5S — CID 23892486
[(E,1R,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-methylsulfanylphenyl)carbamate (PubChem CID 23892486) has the molecular formula C33H31Br2N3O5S and a molecular weight of 741.50 g/mol. Its IUPAC name is [(E,1R,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-methylsulfanylphenyl)carbamate.
| Compound Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
|---|---|
| PubChem CID | 23892486 |
| Molecular Formula | C33H31Br2N3O5S |
| Molecular Weight | 741.50 g/mol |
| Exact Mass | 739.04 |
| IUPAC Name | [(E,1R,2R)-7-(2-aminoanilino)-1-(3,5-dibromo-2-hydroxyphenyl)-7-oxo-2-phenoxyhept-5-enyl] N-(4-methylsulfanylphenyl)carbamate |
| SMILES | CSc1ccc(NC(=O)O[C@H](c2cc(Br)cc(Br)c2O)[C@@H](CC/C=C/C(=O)Nc2ccccc2N)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C33H31Br2N3O5S/c1-44-24-17-15-22(16-18-24)37-33(41)43-32(25-19-21(34)20-26(35)31(25)40)29(42-23-9-3-2-4-10-23)13-7-8-14-30(39)38-28-12-6-5-11-27(28)36/h2-6,8-12,14-20,29,32,40H,7,13,36H2,1H3,(H,37,41)(H,38,39)/b14-8+/t29-,32-/m1/s1 |
| InChIKey | WJLDKNUGWODIIG-VQANSPBJSA-N |
| XLogP | 8.93 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 741.50 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|