C21H19IN2O5 — CID 23892608
(E,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(2-hydroxy-5-iodophenyl)hept-2-enoic acid (PubChem CID 23892608) has the molecular formula C21H19IN2O5 and a molecular weight of 506.30 g/mol. Its IUPAC name is (E,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(2-hydroxy-5-iodophenyl)hept-2-enoic acid.
| Compound Name | (E,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(2-hydroxy-5-iodophenyl)hept-2-enoic acid |
|---|---|
| PubChem CID | 23892608 |
| Molecular Formula | C21H19IN2O5 |
| Molecular Weight | 506.30 g/mol |
| Exact Mass | 506.03 |
| IUPAC Name | (E,7R)-7-[(4-cyanophenyl)carbamoyloxy]-7-(2-hydroxy-5-iodophenyl)hept-2-enoic acid |
| SMILES | N#Cc1ccc(NC(=O)O[C@H](CCC/C=C/C(=O)O)c2cc(I)ccc2O)cc1 |
| InChI | InChI=1S/C21H19IN2O5/c22-15-8-11-18(25)17(12-15)19(4-2-1-3-5-20(26)27)29-21(28)24-16-9-6-14(13-23)7-10-16/h3,5-12,19,25H,1-2,4H2,(H,24,28)(H,26,27)/b5-3+/t19-/m1/s1 |
| InChIKey | XPSDVHFAFGNISK-MEDHRJKHSA-N |
| XLogP | 4.97 |
| TPSA | 119.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.30 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|